C16H26Si2 — CID 71383002
trimethyl-(4-phenyl-1-trimethylsilylbuta-1,3-dienyl)silane (PubChem CID 71383002) has the molecular formula C16H26Si2 and a molecular weight of 274.56 g/mol. Its IUPAC name is trimethyl-(4-phenyl-1-trimethylsilylbuta-1,3-dienyl)silane.
| Compound Name | trimethyl-(4-phenyl-1-trimethylsilylbuta-1,3-dienyl)silane |
|---|---|
| PubChem CID | 71383002 |
| Molecular Formula | C16H26Si2 |
| Molecular Weight | 274.56 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | trimethyl-(4-phenyl-1-trimethylsilylbuta-1,3-dienyl)silane |
| SMILES | C[Si](C)(C)C(=CC=Cc1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C16H26Si2/c1-17(2,3)16(18(4,5)6)14-10-13-15-11-8-7-9-12-15/h7-14H,1-6H3 |
| InChIKey | GZJVTMXWODHDGC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.56 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|