C14H19ClSi — CID 134978697
[(2Z,4E)-1-chloro-5-phenylpenta-2,4-dien-2-yl]-trimethylsilane (PubChem CID 134978697) has the molecular formula C14H19ClSi and a molecular weight of 250.85 g/mol. Its IUPAC name is [(2Z,4E)-1-chloro-5-phenylpenta-2,4-dien-2-yl]-trimethylsilane.
| Compound Name | [(2Z,4E)-1-chloro-5-phenylpenta-2,4-dien-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 134978697 |
| Molecular Formula | C14H19ClSi |
| Molecular Weight | 250.85 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | [(2Z,4E)-1-chloro-5-phenylpenta-2,4-dien-2-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)/C(=C\C=C\c1ccccc1)CCl |
| InChI | InChI=1S/C14H19ClSi/c1-16(2,3)14(12-15)11-7-10-13-8-5-4-6-9-13/h4-11H,12H2,1-3H3/b10-7+,14-11- |
| InChIKey | JUHIPJUKMGQMHI-KSMSJBKCSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.85 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|