C15H12Cl2N2 — CID 12572987
4-chloro-6-[(1Z,3E)-1-chloro-4-phenylbuta-1,3-dienyl]-2-methylpyrimidine (PubChem CID 12572987) has the molecular formula C15H12Cl2N2 and a molecular weight of 291.18 g/mol. Its IUPAC name is 4-chloro-6-[(1Z,3E)-1-chloro-4-phenylbuta-1,3-dienyl]-2-methylpyrimidine.
| Compound Name | 4-chloro-6-[(1Z,3E)-1-chloro-4-phenylbuta-1,3-dienyl]-2-methylpyrimidine |
|---|---|
| PubChem CID | 12572987 |
| Molecular Formula | C15H12Cl2N2 |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 4-chloro-6-[(1Z,3E)-1-chloro-4-phenylbuta-1,3-dienyl]-2-methylpyrimidine |
| SMILES | Cc1nc(Cl)cc(/C(Cl)=C/C=C/c2ccccc2)n1 |
| InChI | InChI=1S/C15H12Cl2N2/c1-11-18-14(10-15(17)19-11)13(16)9-5-8-12-6-3-2-4-7-12/h2-10H,1H3/b8-5+,13-9- |
| InChIKey | MEIWMDHQJVUOBM-GKPGWJKISA-N |
| XLogP | 4.73 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|