About N-(1-chloro-4-phenylbuta-1,3-dienyl)aniline
N-(1-chloro-4-phenylbuta-1,3-dienyl)aniline (PubChem CID 174492569) has the molecular formula C16H14ClN
and a molecular weight of 255.75 g/mol. Its IUPAC name is N-(1-chloro-4-phenylbuta-1,3-dienyl)aniline.
Molecular Properties
| Compound Name | N-(1-chloro-4-phenylbuta-1,3-dienyl)aniline |
| PubChem CID | 174492569 |
| Molecular Formula | C16H14ClN |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | N-(1-chloro-4-phenylbuta-1,3-dienyl)aniline |
| SMILES | ClC(=CC=Cc1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C16H14ClN/c17-16(18-15-11-5-2-6-12-15)13-7-10-14-8-3-1-4-9-14/h1-13,18H |
| InChIKey | QSGUGKCQCZATBW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(1-chloro-4-phenylbuta-1,3-dienyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-chloro-4-phenylbuta-1,3-dienyl)aniline?
The IUPAC name of N-(1-chloro-4-phenylbuta-1,3-dienyl)aniline (CID 174492569) is N-(1-chloro-4-phenylbuta-1,3-dienyl)aniline.
What is the SMILES notation for N-(1-chloro-4-phenylbuta-1,3-dienyl)aniline?
The canonical SMILES for N-(1-chloro-4-phenylbuta-1,3-dienyl)aniline is ClC(=CC=Cc1ccccc1)Nc1ccccc1.
What is the InChIKey of N-(1-chloro-4-phenylbuta-1,3-dienyl)aniline?
The InChIKey is QSGUGKCQCZATBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClN/c17-16(18-15-11-5-2-6-12-15)13-7-10-14-8-3-1-4-9-14/h1-13,18H.
What are the key properties of N-(1-chloro-4-phenylbuta-1,3-dienyl)aniline?
N-(1-chloro-4-phenylbuta-1,3-dienyl)aniline has a molecular weight of 255.75 g/mol, XLogP of 4.89, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-chloro-4-phenylbuta-1,3-dienyl)aniline is sourced from PubChem (CID 174492569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).