C21H20O2 — CID 173461452
cyclopropylmethyl 5-(4-phenylphenyl)penta-2,4-dienoate (PubChem CID 173461452) has the molecular formula C21H20O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is cyclopropylmethyl 5-(4-phenylphenyl)penta-2,4-dienoate.
| Compound Name | cyclopropylmethyl 5-(4-phenylphenyl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 173461452 |
| Molecular Formula | C21H20O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | cyclopropylmethyl 5-(4-phenylphenyl)penta-2,4-dienoate |
| SMILES | O=C(C=CC=Cc1ccc(-c2ccccc2)cc1)OCC1CC1 |
| InChI | InChI=1S/C21H20O2/c22-21(23-16-18-10-11-18)9-5-4-6-17-12-14-20(15-13-17)19-7-2-1-3-8-19/h1-9,12-15,18H,10-11,16H2 |
| InChIKey | RUOHUIRIWGAUDN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|