C23H32O4 — CID 153307202
[4-[[(E)-3-(4-methylphenyl)prop-2-enoyl]oxymethyl]cyclohexyl]methyl 2-methylbutanoate (PubChem CID 153307202) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is [4-[[(E)-3-(4-methylphenyl)prop-2-enoyl]oxymethyl]cyclohexyl]methyl 2-methylbutanoate.
| Compound Name | [4-[[(E)-3-(4-methylphenyl)prop-2-enoyl]oxymethyl]cyclohexyl]methyl 2-methylbutanoate |
|---|---|
| PubChem CID | 153307202 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | [4-[[(E)-3-(4-methylphenyl)prop-2-enoyl]oxymethyl]cyclohexyl]methyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCC1CCC(COC(=O)/C=C/c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C23H32O4/c1-4-18(3)23(25)27-16-21-11-9-20(10-12-21)15-26-22(24)14-13-19-7-5-17(2)6-8-19/h5-8,13-14,18,20-21H,4,9-12,15-16H2,1-3H3/b14-13+ |
| InChIKey | WYUZRLDTFHNRBD-BUHFOSPRSA-N |
| XLogP | 4.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|