About 2-oxopropyl (E)-3-(4-methylphenyl)prop-2-enoate
2-oxopropyl (E)-3-(4-methylphenyl)prop-2-enoate (PubChem CID 55304934) has the molecular formula C13H14O3
and a molecular weight of 218.25 g/mol. Its IUPAC name is 2-oxopropyl (E)-3-(4-methylphenyl)prop-2-enoate.
Molecular Properties
| Compound Name | 2-oxopropyl (E)-3-(4-methylphenyl)prop-2-enoate |
| PubChem CID | 55304934 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 2-oxopropyl (E)-3-(4-methylphenyl)prop-2-enoate |
| SMILES | CC(=O)COC(=O)/C=C/c1ccc(C)cc1 |
| InChI | InChI=1S/C13H14O3/c1-10-3-5-12(6-4-10)7-8-13(15)16-9-11(2)14/h3-8H,9H2,1-2H3/b8-7+ |
| InChIKey | QWDPDPWZKTURHL-BQYQJAHWSA-N |
| XLogP | 2.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-oxopropyl (E)-3-(4-methylphenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxopropyl (E)-3-(4-methylphenyl)prop-2-enoate?
The IUPAC name of 2-oxopropyl (E)-3-(4-methylphenyl)prop-2-enoate (CID 55304934) is 2-oxopropyl (E)-3-(4-methylphenyl)prop-2-enoate.
What is the SMILES notation for 2-oxopropyl (E)-3-(4-methylphenyl)prop-2-enoate?
The canonical SMILES for 2-oxopropyl (E)-3-(4-methylphenyl)prop-2-enoate is CC(=O)COC(=O)/C=C/c1ccc(C)cc1.
What is the InChIKey of 2-oxopropyl (E)-3-(4-methylphenyl)prop-2-enoate?
The InChIKey is QWDPDPWZKTURHL-BQYQJAHWSA-N. The full InChI is InChI=1S/C13H14O3/c1-10-3-5-12(6-4-10)7-8-13(15)16-9-11(2)14/h3-8H,9H2,1-2H3/b8-7+.
What are the key properties of 2-oxopropyl (E)-3-(4-methylphenyl)prop-2-enoate?
2-oxopropyl (E)-3-(4-methylphenyl)prop-2-enoate has a molecular weight of 218.25 g/mol, XLogP of 2.14, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxopropyl (E)-3-(4-methylphenyl)prop-2-enoate is sourced from PubChem (CID 55304934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).