C16H9F5O2 — CID 87281040
(2,3,4,5,6-pentafluorophenyl) (E)-3-(4-methylphenyl)prop-2-enoate (PubChem CID 87281040) has the molecular formula C16H9F5O2 and a molecular weight of 328.24 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (E)-3-(4-methylphenyl)prop-2-enoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (E)-3-(4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 87281040 |
| Molecular Formula | C16H9F5O2 |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (E)-3-(4-methylphenyl)prop-2-enoate |
| SMILES | Cc1ccc(/C=C/C(=O)Oc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C16H9F5O2/c1-8-2-4-9(5-3-8)6-7-10(22)23-16-14(20)12(18)11(17)13(19)15(16)21/h2-7H,1H3/b7-6+ |
| InChIKey | WORFTDPRCCUGFT-VOTSOKGWSA-N |
| XLogP | 4.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|