C21H32N2O2 — CID 59230395
2-methylbutyl (E)-3-[4-[(4-aminocyclohexyl)methylamino]phenyl]prop-2-enoate (PubChem CID 59230395) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 2-methylbutyl (E)-3-[4-[(4-aminocyclohexyl)methylamino]phenyl]prop-2-enoate.
| Compound Name | 2-methylbutyl (E)-3-[4-[(4-aminocyclohexyl)methylamino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 59230395 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | 2-methylbutyl (E)-3-[4-[(4-aminocyclohexyl)methylamino]phenyl]prop-2-enoate |
| SMILES | CCC(C)COC(=O)/C=C/c1ccc(NCC2CCC(N)CC2)cc1 |
| InChI | InChI=1S/C21H32N2O2/c1-3-16(2)15-25-21(24)13-8-17-6-11-20(12-7-17)23-14-18-4-9-19(22)10-5-18/h6-8,11-13,16,18-19,23H,3-5,9-10,14-15,22H2,1-2H3/b13-8+ |
| InChIKey | JEJPPAMZGTVRSY-MDWZMJQESA-N |
| XLogP | 4.22 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|