C19H28N2O3 — CID 89214973
2-methylbutyl (E)-3-[4-(5-aminopentanoylamino)phenyl]prop-2-enoate (PubChem CID 89214973) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is 2-methylbutyl (E)-3-[4-(5-aminopentanoylamino)phenyl]prop-2-enoate.
| Compound Name | 2-methylbutyl (E)-3-[4-(5-aminopentanoylamino)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 89214973 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 2-methylbutyl (E)-3-[4-(5-aminopentanoylamino)phenyl]prop-2-enoate |
| SMILES | CCC(C)COC(=O)/C=C/c1ccc(NC(=O)CCCCN)cc1 |
| InChI | InChI=1S/C19H28N2O3/c1-3-15(2)14-24-19(23)12-9-16-7-10-17(11-8-16)21-18(22)6-4-5-13-20/h7-12,15H,3-6,13-14,20H2,1-2H3,(H,21,22)/b12-9+ |
| InChIKey | DGHXZJWNJRDATL-FMIVXFBMSA-N |
| XLogP | 3.36 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|