C21H28N2O6 — CID 18266680
[2-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]anilino]-2-oxoethyl] 2-(2,2-dimethylpropanoylamino)propanoate (PubChem CID 18266680) has the molecular formula C21H28N2O6 and a molecular weight of 404.46 g/mol. Its IUPAC name is [2-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]anilino]-2-oxoethyl] 2-(2,2-dimethylpropanoylamino)propanoate.
| Compound Name | [2-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]anilino]-2-oxoethyl] 2-(2,2-dimethylpropanoylamino)propanoate |
|---|---|
| PubChem CID | 18266680 |
| Molecular Formula | C21H28N2O6 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | [2-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]anilino]-2-oxoethyl] 2-(2,2-dimethylpropanoylamino)propanoate |
| SMILES | CCOC(=O)/C=C/c1ccc(NC(=O)COC(=O)C(C)NC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H28N2O6/c1-6-28-18(25)12-9-15-7-10-16(11-8-15)23-17(24)13-29-19(26)14(2)22-20(27)21(3,4)5/h7-12,14H,6,13H2,1-5H3,(H,22,27)(H,23,24)/b12-9+ |
| InChIKey | XNIGYNBEKHBHKQ-FMIVXFBMSA-N |
| XLogP | 2.30 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|