C22H28N2O2 — CID 67802373
[(2R)-2-methylbutyl] (E)-3-[4-(5-butylpyrimidin-2-yl)phenyl]prop-2-enoate (PubChem CID 67802373) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is [(2R)-2-methylbutyl] (E)-3-[4-(5-butylpyrimidin-2-yl)phenyl]prop-2-enoate.
| Compound Name | [(2R)-2-methylbutyl] (E)-3-[4-(5-butylpyrimidin-2-yl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 67802373 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | [(2R)-2-methylbutyl] (E)-3-[4-(5-butylpyrimidin-2-yl)phenyl]prop-2-enoate |
| SMILES | CCCCc1cnc(-c2ccc(/C=C/C(=O)OC[C@H](C)CC)cc2)nc1 |
| InChI | InChI=1S/C22H28N2O2/c1-4-6-7-19-14-23-22(24-15-19)20-11-8-18(9-12-20)10-13-21(25)26-16-17(3)5-2/h8-15,17H,4-7,16H2,1-3H3/b13-10+/t17-/m1/s1 |
| InChIKey | WPXJVQHNTVZMJF-JIIJFUIFSA-N |
| XLogP | 5.09 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|