C25H36N2O2 — CID 139882337
2-methylbutyl 3-[4-(5-hexylpyrimidin-2-yl)phenyl]-2-methylpropanoate (PubChem CID 139882337) has the molecular formula C25H36N2O2 and a molecular weight of 396.58 g/mol. Its IUPAC name is 2-methylbutyl 3-[4-(5-hexylpyrimidin-2-yl)phenyl]-2-methylpropanoate.
| Compound Name | 2-methylbutyl 3-[4-(5-hexylpyrimidin-2-yl)phenyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 139882337 |
| Molecular Formula | C25H36N2O2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | 2-methylbutyl 3-[4-(5-hexylpyrimidin-2-yl)phenyl]-2-methylpropanoate |
| SMILES | CCCCCCc1cnc(-c2ccc(CC(C)C(=O)OCC(C)CC)cc2)nc1 |
| InChI | InChI=1S/C25H36N2O2/c1-5-7-8-9-10-22-16-26-24(27-17-22)23-13-11-21(12-14-23)15-20(4)25(28)29-18-19(3)6-2/h11-14,16-17,19-20H,5-10,15,18H2,1-4H3 |
| InChIKey | YBESVTSEXJFMAS-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|