C23H30N2O2 — CID 54224519
[(2R)-2-methylbutyl] 3-[4-(5-pentylpyrimidin-2-yl)phenyl]prop-2-enoate (PubChem CID 54224519) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is [(2R)-2-methylbutyl] 3-[4-(5-pentylpyrimidin-2-yl)phenyl]prop-2-enoate.
| Compound Name | [(2R)-2-methylbutyl] 3-[4-(5-pentylpyrimidin-2-yl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 54224519 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | [(2R)-2-methylbutyl] 3-[4-(5-pentylpyrimidin-2-yl)phenyl]prop-2-enoate |
| SMILES | CCCCCc1cnc(-c2ccc(C=CC(=O)OC[C@H](C)CC)cc2)nc1 |
| InChI | InChI=1S/C23H30N2O2/c1-4-6-7-8-20-15-24-23(25-16-20)21-12-9-19(10-13-21)11-14-22(26)27-17-18(3)5-2/h9-16,18H,4-8,17H2,1-3H3/t18-/m1/s1 |
| InChIKey | QEXNIWKIKKCLPX-GOSISDBHSA-N |
| XLogP | 5.48 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|