C22H24F4N2O2 — CID 54217406
2,2,3,3-tetrafluoropropyl 3-[4-(5-hexylpyrimidin-2-yl)phenyl]prop-2-enoate (PubChem CID 54217406) has the molecular formula C22H24F4N2O2 and a molecular weight of 424.44 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropyl 3-[4-(5-hexylpyrimidin-2-yl)phenyl]prop-2-enoate.
| Compound Name | 2,2,3,3-tetrafluoropropyl 3-[4-(5-hexylpyrimidin-2-yl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 54217406 |
| Molecular Formula | C22H24F4N2O2 |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl 3-[4-(5-hexylpyrimidin-2-yl)phenyl]prop-2-enoate |
| SMILES | CCCCCCc1cnc(-c2ccc(C=CC(=O)OCC(F)(F)C(F)F)cc2)nc1 |
| InChI | InChI=1S/C22H24F4N2O2/c1-2-3-4-5-6-17-13-27-20(28-14-17)18-10-7-16(8-11-18)9-12-19(29)30-15-22(25,26)21(23)24/h7-14,21H,2-6,15H2,1H3 |
| InChIKey | QAEKWSCTRYVETI-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|