C20H28Cl3NO3Si — CID 140988216
6-trichlorosilylhexyl (E)-3-[4-(pentanoylamino)phenyl]prop-2-enoate (PubChem CID 140988216) has the molecular formula C20H28Cl3NO3Si and a molecular weight of 464.89 g/mol. Its IUPAC name is 6-trichlorosilylhexyl (E)-3-[4-(pentanoylamino)phenyl]prop-2-enoate.
| Compound Name | 6-trichlorosilylhexyl (E)-3-[4-(pentanoylamino)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 140988216 |
| Molecular Formula | C20H28Cl3NO3Si |
| Molecular Weight | 464.89 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | 6-trichlorosilylhexyl (E)-3-[4-(pentanoylamino)phenyl]prop-2-enoate |
| SMILES | CCCCC(=O)Nc1ccc(/C=C/C(=O)OCCCCCC[Si](Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C20H28Cl3NO3Si/c1-2-3-8-19(25)24-18-12-9-17(10-13-18)11-14-20(26)27-15-6-4-5-7-16-28(21,22)23/h9-14H,2-8,15-16H2,1H3,(H,24,25)/b14-11+ |
| InChIKey | IOMPHHQWSGFGNI-SDNWHVSQSA-N |
| XLogP | 6.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.89 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|