C36H31NO2 — CID 58403190
methyl (E)-3-[4-[N-(3,4-dimethylphenyl)-4-(4-phenylphenyl)anilino]phenyl]prop-2-enoate (PubChem CID 58403190) has the molecular formula C36H31NO2 and a molecular weight of 509.65 g/mol. Its IUPAC name is methyl (E)-3-[4-[N-(3,4-dimethylphenyl)-4-(4-phenylphenyl)anilino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[N-(3,4-dimethylphenyl)-4-(4-phenylphenyl)anilino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 58403190 |
| Molecular Formula | C36H31NO2 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | methyl (E)-3-[4-[N-(3,4-dimethylphenyl)-4-(4-phenylphenyl)anilino]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(N(c2ccc(-c3ccc(-c4ccccc4)cc3)cc2)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C36H31NO2/c1-26-9-19-35(25-27(26)2)37(33-20-10-28(11-21-33)12-24-36(38)39-3)34-22-17-32(18-23-34)31-15-13-30(14-16-31)29-7-5-4-6-8-29/h4-25H,1-3H3/b24-12+ |
| InChIKey | LJDWOPCYIIPZJR-WYMPLXKRSA-N |
| XLogP | 9.29 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|