About hexafluoroarsenic(1-);tetraphenylarsanium
hexafluoroarsenic(1-);tetraphenylarsanium (PubChem CID 14223279) has the molecular formula C24H20As2F6
and a molecular weight of 572.26 g/mol. Its IUPAC name is hexafluoroarsenic(1-);tetraphenylarsanium.
Molecular Properties
| Compound Name | hexafluoroarsenic(1-);tetraphenylarsanium |
| PubChem CID | 14223279 |
| Molecular Formula | C24H20As2F6 |
| Molecular Weight | 572.26 g/mol |
| Exact Mass | 571.99 |
| IUPAC Name | hexafluoroarsenic(1-);tetraphenylarsanium |
| SMILES | F[As-](F)(F)(F)(F)F.c1ccc([As+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20As.AsF6/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;2-1(3,4,5,6)7/h1-20H;/q+1;-1 |
| InChIKey | MWMXLSXSQBNFIP-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 572.26 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze hexafluoroarsenic(1-);tetraphenylarsanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexafluoroarsenic(1-);tetraphenylarsanium?
The IUPAC name of hexafluoroarsenic(1-);tetraphenylarsanium (CID 14223279) is hexafluoroarsenic(1-);tetraphenylarsanium.
What is the SMILES notation for hexafluoroarsenic(1-);tetraphenylarsanium?
The canonical SMILES for hexafluoroarsenic(1-);tetraphenylarsanium is F[As-](F)(F)(F)(F)F.c1ccc([As+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of hexafluoroarsenic(1-);tetraphenylarsanium?
The InChIKey is MWMXLSXSQBNFIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20As.AsF6/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;2-1(3,4,5,6)7/h1-20H;/q+1;-1.
What are the key properties of hexafluoroarsenic(1-);tetraphenylarsanium?
hexafluoroarsenic(1-);tetraphenylarsanium has a molecular weight of 572.26 g/mol, XLogP of 5.20, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hexafluoroarsenic(1-);tetraphenylarsanium is sourced from PubChem (CID 14223279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).