About tetraphenylarsanium;chloride;hydroiodide
tetraphenylarsanium;chloride;hydroiodide (PubChem CID 172799247) has the molecular formula C24H21AsClI
and a molecular weight of 546.71 g/mol. Its IUPAC name is tetraphenylarsanium;chloride;hydroiodide.
Molecular Properties
| Compound Name | tetraphenylarsanium;chloride;hydroiodide |
| PubChem CID | 172799247 |
| Molecular Formula | C24H21AsClI |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 545.96 |
| IUPAC Name | tetraphenylarsanium;chloride;hydroiodide |
| SMILES | I.[Cl-].c1ccc([As+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20As.ClH.HI/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;;/h1-20H;2*1H/q+1;;/p-1 |
| InChIKey | XXJBZCAZLGYYEM-UHFFFAOYSA-M |
| XLogP | 0.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze tetraphenylarsanium;chloride;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetraphenylarsanium;chloride;hydroiodide?
The IUPAC name of tetraphenylarsanium;chloride;hydroiodide (CID 172799247) is tetraphenylarsanium;chloride;hydroiodide.
What is the SMILES notation for tetraphenylarsanium;chloride;hydroiodide?
The canonical SMILES for tetraphenylarsanium;chloride;hydroiodide is I.[Cl-].c1ccc([As+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of tetraphenylarsanium;chloride;hydroiodide?
The InChIKey is XXJBZCAZLGYYEM-UHFFFAOYSA-M. The full InChI is InChI=1S/C24H20As.ClH.HI/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;;/h1-20H;2*1H/q+1;;/p-1.
What are the key properties of tetraphenylarsanium;chloride;hydroiodide?
tetraphenylarsanium;chloride;hydroiodide has a molecular weight of 546.71 g/mol, XLogP of 0.69, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetraphenylarsanium;chloride;hydroiodide is sourced from PubChem (CID 172799247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).