About tetraphenylphosphanium bromide
tetraphenylphosphanium bromide (PubChem CID 2724163) has the molecular formula C24H20BrP
and a molecular weight of 419.30 g/mol. Its IUPAC name is tetraphenylphosphanium bromide.
Molecular Properties
| Compound Name | tetraphenylphosphanium bromide |
| PubChem CID | 2724163 |
| Molecular Formula | C24H20BrP |
| Molecular Weight | 419.30 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | tetraphenylphosphanium bromide |
| SMILES | [Br-].c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20P.BrH/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;/h1-20H;1H/q+1;/p-1 |
| InChIKey | BRKFQVAOMSWFDU-UHFFFAOYSA-M |
| XLogP | 1.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tetraphenylphosphanium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetraphenylphosphanium bromide?
The IUPAC name of tetraphenylphosphanium bromide (CID 2724163) is tetraphenylphosphanium bromide.
What is the SMILES notation for tetraphenylphosphanium bromide?
The canonical SMILES for tetraphenylphosphanium bromide is [Br-].c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of tetraphenylphosphanium bromide?
The InChIKey is BRKFQVAOMSWFDU-UHFFFAOYSA-M. The full InChI is InChI=1S/C24H20P.BrH/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;/h1-20H;1H/q+1;/p-1.
What are the key properties of tetraphenylphosphanium bromide?
tetraphenylphosphanium bromide has a molecular weight of 419.30 g/mol, XLogP of 1.31, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetraphenylphosphanium bromide is sourced from PubChem (CID 2724163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).