About Nickel, dichlorobis(triphenylphosphine)-
Nickel, dichlorobis(triphenylphosphine)- (PubChem CID 498315) has the molecular formula C36H30Cl2NiP2
and a molecular weight of 654.20 g/mol. Its IUPAC name is dichloronickel;bis(triphenylphosphane).
Molecular Properties
| Compound Name | Nickel, dichlorobis(triphenylphosphine)- |
| PubChem CID | 498315 |
| Molecular Formula | C36H30Cl2NiP2 |
| Molecular Weight | 654.20 g/mol |
| Exact Mass | 652.06 |
| IUPAC Name | dichloronickel;bis(triphenylphosphane) |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.Cl[Ni]Cl |
| InChI | InChI=1S/2C18H15P.2ClH.Ni/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h2*1-15H;2*1H;/q;;;;+2/p-2 |
| InChIKey | ZBRJXVVKPBZPAN-UHFFFAOYSA-L |
| XLogP | — |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | 204 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 654.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze Nickel, dichlorobis(triphenylphosphine)- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Nickel, dichlorobis(triphenylphosphine)-?
The IUPAC name of Nickel, dichlorobis(triphenylphosphine)- (CID 498315) is dichloronickel;bis(triphenylphosphane).
What is the SMILES notation for Nickel, dichlorobis(triphenylphosphine)-?
The canonical SMILES for Nickel, dichlorobis(triphenylphosphine)- is C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.Cl[Ni]Cl.
What is the InChIKey of Nickel, dichlorobis(triphenylphosphine)-?
The InChIKey is ZBRJXVVKPBZPAN-UHFFFAOYSA-L. The full InChI is InChI=1S/2C18H15P.2ClH.Ni/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h2*1-15H;2*1H;/q;;;;+2/p-2.
What are the key properties of Nickel, dichlorobis(triphenylphosphine)-?
Nickel, dichlorobis(triphenylphosphine)- has a molecular weight of 654.20 g/mol, XLogP of not available, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Nickel, dichlorobis(triphenylphosphine)- is sourced from PubChem (CID 498315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).