About sulfuric acid;trifluoromethanesulfinate
sulfuric acid;trifluoromethanesulfinate (PubChem CID 175095514) has the molecular formula CH2F3O6S2-
and a molecular weight of 231.15 g/mol. Its IUPAC name is sulfuric acid;trifluoromethanesulfinate.
Molecular Properties
| Compound Name | sulfuric acid;trifluoromethanesulfinate |
| PubChem CID | 175095514 |
| Molecular Formula | CH2F3O6S2- |
| Molecular Weight | 231.15 g/mol |
| Exact Mass | 230.93 |
| IUPAC Name | sulfuric acid;trifluoromethanesulfinate |
| SMILES | O=S(=O)(O)O.O=S([O-])C(F)(F)F |
| InChI | InChI=1S/CHF3O2S.H2O4S/c2-1(3,4)7(5)6;1-5(2,3)4/h(H,5,6);(H2,1,2,3,4)/p-1 |
| InChIKey | GNNGVGJGEOOGFF-UHFFFAOYSA-M |
| XLogP | -0.27 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.15 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sulfuric acid;trifluoromethanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfuric acid;trifluoromethanesulfinate?
The IUPAC name of sulfuric acid;trifluoromethanesulfinate (CID 175095514) is sulfuric acid;trifluoromethanesulfinate.
What is the SMILES notation for sulfuric acid;trifluoromethanesulfinate?
The canonical SMILES for sulfuric acid;trifluoromethanesulfinate is O=S(=O)(O)O.O=S([O-])C(F)(F)F.
What is the InChIKey of sulfuric acid;trifluoromethanesulfinate?
The InChIKey is GNNGVGJGEOOGFF-UHFFFAOYSA-M. The full InChI is InChI=1S/CHF3O2S.H2O4S/c2-1(3,4)7(5)6;1-5(2,3)4/h(H,5,6);(H2,1,2,3,4)/p-1.
What are the key properties of sulfuric acid;trifluoromethanesulfinate?
sulfuric acid;trifluoromethanesulfinate has a molecular weight of 231.15 g/mol, XLogP of -0.27, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sulfuric acid;trifluoromethanesulfinate is sourced from PubChem (CID 175095514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).