C6H11F2LiO3S — CID 122481859
lithium 1,1-difluorohexane-1-sulfonate (PubChem CID 122481859) has the molecular formula C6H11F2LiO3S and a molecular weight of 208.15 g/mol. Its IUPAC name is lithium 1,1-difluorohexane-1-sulfonate.
| Compound Name | lithium 1,1-difluorohexane-1-sulfonate |
|---|---|
| PubChem CID | 122481859 |
| Molecular Formula | C6H11F2LiO3S |
| Molecular Weight | 208.15 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | lithium 1,1-difluorohexane-1-sulfonate |
| SMILES | CCCCCC(F)(F)S(=O)(=O)[O-].[Li+] |
| InChI | InChI=1S/C6H12F2O3S.Li/c1-2-3-4-5-6(7,8)12(9,10)11;/h2-5H2,1H3,(H,9,10,11);/q;+1/p-1 |
| InChIKey | HTQGPZHMFMVNMD-UHFFFAOYSA-M |
| XLogP | -1.29 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.15 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|