C2H2F3LiO3S — CID 23700454
lithium 1,1,2-trifluoroethanesulfonate (PubChem CID 23700454) has the molecular formula C2H2F3LiO3S and a molecular weight of 170.04 g/mol. Its IUPAC name is lithium 1,1,2-trifluoroethanesulfonate.
| Compound Name | lithium 1,1,2-trifluoroethanesulfonate |
|---|---|
| PubChem CID | 23700454 |
| Molecular Formula | C2H2F3LiO3S |
| Molecular Weight | 170.04 g/mol |
| Exact Mass | 169.98 |
| IUPAC Name | lithium 1,1,2-trifluoroethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)CF.[Li+] |
| InChI | InChI=1S/C2H3F3O3S.Li/c3-1-2(4,5)9(6,7)8;/h1H2,(H,6,7,8);/q;+1/p-1 |
| InChIKey | QLWWDZMGWGAADP-UHFFFAOYSA-M |
| XLogP | -2.90 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.04 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|