C4H2F7KO3S — CID 122482027
potassium 1,1,2,2,3,3,4-heptafluorobutane-1-sulfonate (PubChem CID 122482027) has the molecular formula C4H2F7KO3S and a molecular weight of 302.21 g/mol. Its IUPAC name is potassium 1,1,2,2,3,3,4-heptafluorobutane-1-sulfonate.
| Compound Name | potassium 1,1,2,2,3,3,4-heptafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 122482027 |
| Molecular Formula | C4H2F7KO3S |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 301.92 |
| IUPAC Name | potassium 1,1,2,2,3,3,4-heptafluorobutane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)CF.[K+] |
| InChI | InChI=1S/C4H3F7O3S.K/c5-1-2(6,7)3(8,9)4(10,11)15(12,13)14;/h1H2,(H,12,13,14);/q;+1/p-1 |
| InChIKey | FZNKYAIZNAYAGV-UHFFFAOYSA-M |
| XLogP | -1.63 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|