About 2,3-diaminobenzenesulfonate;triethylazanium
2,3-diaminobenzenesulfonate;triethylazanium (PubChem CID 139707303) has the molecular formula C12H23N3O3S
and a molecular weight of 289.40 g/mol. Its IUPAC name is 2,3-diaminobenzenesulfonate;triethylazanium.
Molecular Properties
| Compound Name | 2,3-diaminobenzenesulfonate;triethylazanium |
| PubChem CID | 139707303 |
| Molecular Formula | C12H23N3O3S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 2,3-diaminobenzenesulfonate;triethylazanium |
| SMILES | CC[NH+](CC)CC.Nc1cccc(S(=O)(=O)[O-])c1N |
| InChI | InChI=1S/C6H8N2O3S.C6H15N/c7-4-2-1-3-5(6(4)8)12(9,10)11;1-4-7(5-2)6-3/h1-3H,7-8H2,(H,9,10,11);4-6H2,1-3H3 |
| InChIKey | QWFMIRLYKBAKQI-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diaminobenzenesulfonate;triethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diaminobenzenesulfonate;triethylazanium?
The IUPAC name of 2,3-diaminobenzenesulfonate;triethylazanium (CID 139707303) is 2,3-diaminobenzenesulfonate;triethylazanium.
What is the SMILES notation for 2,3-diaminobenzenesulfonate;triethylazanium?
The canonical SMILES for 2,3-diaminobenzenesulfonate;triethylazanium is CC[NH+](CC)CC.Nc1cccc(S(=O)(=O)[O-])c1N.
What is the InChIKey of 2,3-diaminobenzenesulfonate;triethylazanium?
The InChIKey is QWFMIRLYKBAKQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O3S.C6H15N/c7-4-2-1-3-5(6(4)8)12(9,10)11;1-4-7(5-2)6-3/h1-3H,7-8H2,(H,9,10,11);4-6H2,1-3H3.
What are the key properties of 2,3-diaminobenzenesulfonate;triethylazanium?
2,3-diaminobenzenesulfonate;triethylazanium has a molecular weight of 289.40 g/mol, XLogP of -0.31, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diaminobenzenesulfonate;triethylazanium is sourced from PubChem (CID 139707303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).