C21H41N3O3S — CID 139707306
2,3-diaminobenzenesulfonate;tripentylazanium (PubChem CID 139707306) has the molecular formula C21H41N3O3S and a molecular weight of 415.64 g/mol. Its IUPAC name is 2,3-diaminobenzenesulfonate;tripentylazanium.
| Compound Name | 2,3-diaminobenzenesulfonate;tripentylazanium |
|---|---|
| PubChem CID | 139707306 |
| Molecular Formula | C21H41N3O3S |
| Molecular Weight | 415.64 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | 2,3-diaminobenzenesulfonate;tripentylazanium |
| SMILES | CCCCC[NH+](CCCCC)CCCCC.Nc1cccc(S(=O)(=O)[O-])c1N |
| InChI | InChI=1S/C15H33N.C6H8N2O3S/c1-4-7-10-13-16(14-11-8-5-2)15-12-9-6-3;7-4-2-1-3-5(6(4)8)12(9,10)11/h4-15H2,1-3H3;1-3H,7-8H2,(H,9,10,11) |
| InChIKey | NTGMGPBFZAIZQG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.64 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|