C6H5Li2NO6S2 — CID 101305541
dilithium;2-aminobenzene-1,3-disulfonate (PubChem CID 101305541) has the molecular formula C6H5Li2NO6S2 and a molecular weight of 265.12 g/mol. Its IUPAC name is dilithium;2-aminobenzene-1,3-disulfonate.
| Compound Name | dilithium;2-aminobenzene-1,3-disulfonate |
|---|---|
| PubChem CID | 101305541 |
| Molecular Formula | C6H5Li2NO6S2 |
| Molecular Weight | 265.12 g/mol |
| Exact Mass | 264.99 |
| IUPAC Name | dilithium;2-aminobenzene-1,3-disulfonate |
| SMILES | Nc1c(S(=O)(=O)[O-])cccc1S(=O)(=O)[O-].[Li+].[Li+] |
| InChI | InChI=1S/C6H7NO6S2.2Li/c7-6-4(14(8,9)10)2-1-3-5(6)15(11,12)13;;/h1-3H,7H2,(H,8,9,10)(H,11,12,13);;/q;2*+1/p-2 |
| InChIKey | CLEBMXXZUPMVAQ-UHFFFAOYSA-L |
| XLogP | -6.91 |
| TPSA | 140.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.12 |
| LogP ≤ 5 | -6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|