About 4-hydroxynaphthalene-1-sulfonate;tributylazanium
4-hydroxynaphthalene-1-sulfonate;tributylazanium (PubChem CID 87179244) has the molecular formula C22H35NO4S
and a molecular weight of 409.59 g/mol. Its IUPAC name is 4-hydroxynaphthalene-1-sulfonate;tributylazanium.
Molecular Properties
| Compound Name | 4-hydroxynaphthalene-1-sulfonate;tributylazanium |
| PubChem CID | 87179244 |
| Molecular Formula | C22H35NO4S |
| Molecular Weight | 409.59 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 4-hydroxynaphthalene-1-sulfonate;tributylazanium |
| SMILES | CCCC[NH+](CCCC)CCCC.O=S(=O)([O-])c1ccc(O)c2ccccc12 |
| InChI | InChI=1S/C12H27N.C10H8O4S/c1-4-7-10-13(11-8-5-2)12-9-6-3;11-9-5-6-10(15(12,13)14)8-4-2-1-3-7(8)9/h4-12H2,1-3H3;1-6,11H,(H,12,13,14) |
| InChIKey | VOLWYRLFFMDEJK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 81.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.59 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxynaphthalene-1-sulfonate;tributylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxynaphthalene-1-sulfonate;tributylazanium?
The IUPAC name of 4-hydroxynaphthalene-1-sulfonate;tributylazanium (CID 87179244) is 4-hydroxynaphthalene-1-sulfonate;tributylazanium.
What is the SMILES notation for 4-hydroxynaphthalene-1-sulfonate;tributylazanium?
The canonical SMILES for 4-hydroxynaphthalene-1-sulfonate;tributylazanium is CCCC[NH+](CCCC)CCCC.O=S(=O)([O-])c1ccc(O)c2ccccc12.
What is the InChIKey of 4-hydroxynaphthalene-1-sulfonate;tributylazanium?
The InChIKey is VOLWYRLFFMDEJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N.C10H8O4S/c1-4-7-10-13(11-8-5-2)12-9-6-3;11-9-5-6-10(15(12,13)14)8-4-2-1-3-7(8)9/h4-12H2,1-3H3;1-6,11H,(H,12,13,14).
What are the key properties of 4-hydroxynaphthalene-1-sulfonate;tributylazanium?
4-hydroxynaphthalene-1-sulfonate;tributylazanium has a molecular weight of 409.59 g/mol, XLogP of 3.72, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxynaphthalene-1-sulfonate;tributylazanium is sourced from PubChem (CID 87179244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).