C42H78N4O6S2 — CID 18926774
5-amino-2-(4-amino-2-sulfonatophenyl)benzenesulfonate;bis(tripentylazanium) (PubChem CID 18926774) has the molecular formula C42H78N4O6S2 and a molecular weight of 799.24 g/mol. Its IUPAC name is 5-amino-2-(4-amino-2-sulfonatophenyl)benzenesulfonate;bis(tripentylazanium).
| Compound Name | 5-amino-2-(4-amino-2-sulfonatophenyl)benzenesulfonate;bis(tripentylazanium) |
|---|---|
| PubChem CID | 18926774 |
| Molecular Formula | C42H78N4O6S2 |
| Molecular Weight | 799.24 g/mol |
| Exact Mass | 798.54 |
| IUPAC Name | 5-amino-2-(4-amino-2-sulfonatophenyl)benzenesulfonate;bis(tripentylazanium) |
| SMILES | CCCCC[NH+](CCCCC)CCCCC.CCCCC[NH+](CCCCC)CCCCC.Nc1ccc(-c2ccc(N)cc2S(=O)(=O)[O-])c(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/2C15H33N.C12H12N2O6S2/c2*1-4-7-10-13-16(14-11-8-5-2)15-12-9-6-3;13-7-1-3-9(11(5-7)21(15,16)17)10-4-2-8(14)6-12(10)22(18,19)20/h2*4-15H2,1-3H3;1-6H,13-14H2,(H,15,16,17)(H,18,19,20) |
| InChIKey | XGJUHFLPCGPIRS-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 175.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.24 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|