About tripentylazanium
tripentylazanium (PubChem CID 6993016) has the molecular formula C15H34N+
and a molecular weight of 228.44 g/mol. Its IUPAC name is tripentylazanium.
Molecular Properties
| Compound Name | tripentylazanium |
| PubChem CID | 6993016 |
| Molecular Formula | C15H34N+ |
| Molecular Weight | 228.44 g/mol |
| Exact Mass | 228.27 |
| IUPAC Name | tripentylazanium |
| SMILES | CCCCC[NH+](CCCCC)CCCCC |
| InChI | InChI=1S/C15H33N/c1-4-7-10-13-16(14-11-8-5-2)15-12-9-6-3/h4-15H2,1-3H3/p+1 |
| InChIKey | OOHAUGDGCWURIT-UHFFFAOYSA-O |
| XLogP | 3.44 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tripentylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tripentylazanium?
The IUPAC name of tripentylazanium (CID 6993016) is tripentylazanium.
What is the SMILES notation for tripentylazanium?
The canonical SMILES for tripentylazanium is CCCCC[NH+](CCCCC)CCCCC.
What is the InChIKey of tripentylazanium?
The InChIKey is OOHAUGDGCWURIT-UHFFFAOYSA-O. The full InChI is InChI=1S/C15H33N/c1-4-7-10-13-16(14-11-8-5-2)15-12-9-6-3/h4-15H2,1-3H3/p+1.
What are the key properties of tripentylazanium?
tripentylazanium has a molecular weight of 228.44 g/mol, XLogP of 3.44, 12 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tripentylazanium is sourced from PubChem (CID 6993016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).