About trihexylazanium bromide
trihexylazanium bromide (PubChem CID 54105866) has the molecular formula C18H40BrN
and a molecular weight of 350.43 g/mol. Its IUPAC name is trihexylazanium bromide.
Molecular Properties
| Compound Name | trihexylazanium bromide |
| PubChem CID | 54105866 |
| Molecular Formula | C18H40BrN |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | trihexylazanium bromide |
| SMILES | CCCCCC[NH+](CCCCCC)CCCCCC.[Br-] |
| InChI | InChI=1S/C18H39N.BrH/c1-4-7-10-13-16-19(17-14-11-8-5-2)18-15-12-9-6-3;/h4-18H2,1-3H3;1H |
| InChIKey | OZHVLOFHCQYIJW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze trihexylazanium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trihexylazanium bromide?
The IUPAC name of trihexylazanium bromide (CID 54105866) is trihexylazanium bromide.
What is the SMILES notation for trihexylazanium bromide?
The canonical SMILES for trihexylazanium bromide is CCCCCC[NH+](CCCCCC)CCCCCC.[Br-].
What is the InChIKey of trihexylazanium bromide?
The InChIKey is OZHVLOFHCQYIJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H39N.BrH/c1-4-7-10-13-16-19(17-14-11-8-5-2)18-15-12-9-6-3;/h4-18H2,1-3H3;1H.
What are the key properties of trihexylazanium bromide?
trihexylazanium bromide has a molecular weight of 350.43 g/mol, XLogP of 1.62, 15 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trihexylazanium bromide is sourced from PubChem (CID 54105866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).