About dibutyl(propyl)azanium;propane
dibutyl(propyl)azanium;propane (PubChem CID 176561403) has the molecular formula C14H34N+
and a molecular weight of 216.43 g/mol. Its IUPAC name is dibutyl(propyl)azanium;propane.
Molecular Properties
| Compound Name | dibutyl(propyl)azanium;propane |
| PubChem CID | 176561403 |
| Molecular Formula | C14H34N+ |
| Molecular Weight | 216.43 g/mol |
| Exact Mass | 216.27 |
| IUPAC Name | dibutyl(propyl)azanium;propane |
| SMILES | CCC.CCCC[NH+](CCC)CCCC |
| InChI | InChI=1S/C11H25N.C3H8/c1-4-7-10-12(9-6-3)11-8-5-2;1-3-2/h4-11H2,1-3H3;3H2,1-2H3/p+1 |
| InChIKey | YBDHLWFSAWLRLW-UHFFFAOYSA-O |
| XLogP | 3.30 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze dibutyl(propyl)azanium;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyl(propyl)azanium;propane?
The IUPAC name of dibutyl(propyl)azanium;propane (CID 176561403) is dibutyl(propyl)azanium;propane.
What is the SMILES notation for dibutyl(propyl)azanium;propane?
The canonical SMILES for dibutyl(propyl)azanium;propane is CCC.CCCC[NH+](CCC)CCCC.
What is the InChIKey of dibutyl(propyl)azanium;propane?
The InChIKey is YBDHLWFSAWLRLW-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H25N.C3H8/c1-4-7-10-12(9-6-3)11-8-5-2;1-3-2/h4-11H2,1-3H3;3H2,1-2H3/p+1.
What are the key properties of dibutyl(propyl)azanium;propane?
dibutyl(propyl)azanium;propane has a molecular weight of 216.43 g/mol, XLogP of 3.30, 8 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyl(propyl)azanium;propane is sourced from PubChem (CID 176561403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).