About ethanol;tripropylazanium;hydroxide
ethanol;tripropylazanium;hydroxide (PubChem CID 21313535) has the molecular formula C11H29NO2
and a molecular weight of 207.36 g/mol. Its IUPAC name is ethanol;tripropylazanium;hydroxide.
Molecular Properties
| Compound Name | ethanol;tripropylazanium;hydroxide |
| PubChem CID | 21313535 |
| Molecular Formula | C11H29NO2 |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.22 |
| IUPAC Name | ethanol;tripropylazanium;hydroxide |
| SMILES | CCC[NH+](CCC)CCC.CCO.[OH-] |
| InChI | InChI=1S/C9H21N.C2H6O.H2O/c1-4-7-10(8-5-2)9-6-3;1-2-3;/h4-9H2,1-3H3;3H,2H2,1H3;1H2 |
| InChIKey | YXCBQZBHLAYKLV-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 54.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethanol;tripropylazanium;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;tripropylazanium;hydroxide?
The IUPAC name of ethanol;tripropylazanium;hydroxide (CID 21313535) is ethanol;tripropylazanium;hydroxide.
What is the SMILES notation for ethanol;tripropylazanium;hydroxide?
The canonical SMILES for ethanol;tripropylazanium;hydroxide is CCC[NH+](CCC)CCC.CCO.[OH-].
What is the InChIKey of ethanol;tripropylazanium;hydroxide?
The InChIKey is YXCBQZBHLAYKLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N.C2H6O.H2O/c1-4-7-10(8-5-2)9-6-3;1-2-3;/h4-9H2,1-3H3;3H,2H2,1H3;1H2.
What are the key properties of ethanol;tripropylazanium;hydroxide?
ethanol;tripropylazanium;hydroxide has a molecular weight of 207.36 g/mol, XLogP of 0.92, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;tripropylazanium;hydroxide is sourced from PubChem (CID 21313535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).