About trioctylazanium hydroxide
trioctylazanium hydroxide (PubChem CID 22253318) has the molecular formula C24H53NO
and a molecular weight of 371.69 g/mol. Its IUPAC name is trioctylazanium hydroxide.
Molecular Properties
| Compound Name | trioctylazanium hydroxide |
| PubChem CID | 22253318 |
| Molecular Formula | C24H53NO |
| Molecular Weight | 371.69 g/mol |
| Exact Mass | 371.41 |
| IUPAC Name | trioctylazanium hydroxide |
| SMILES | CCCCCCCC[NH+](CCCCCCCC)CCCCCCCC.[OH-] |
| InChI | InChI=1S/C24H51N.H2O/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;/h4-24H2,1-3H3;1H2 |
| InChIKey | JBFRIFLOBVAOCD-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 34.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.69 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze trioctylazanium hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trioctylazanium hydroxide?
The IUPAC name of trioctylazanium hydroxide (CID 22253318) is trioctylazanium hydroxide.
What is the SMILES notation for trioctylazanium hydroxide?
The canonical SMILES for trioctylazanium hydroxide is CCCCCCCC[NH+](CCCCCCCC)CCCCCCCC.[OH-].
What is the InChIKey of trioctylazanium hydroxide?
The InChIKey is JBFRIFLOBVAOCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H51N.H2O/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;/h4-24H2,1-3H3;1H2.
What are the key properties of trioctylazanium hydroxide?
trioctylazanium hydroxide has a molecular weight of 371.69 g/mol, XLogP of 6.78, 21 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trioctylazanium hydroxide is sourced from PubChem (CID 22253318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).