About hexafluoroarsenic(1-);tripropylazanium
hexafluoroarsenic(1-);tripropylazanium (PubChem CID 45048798) has the molecular formula C9H22AsF6N
and a molecular weight of 333.19 g/mol. Its IUPAC name is hexafluoroarsenic(1-);tripropylazanium.
Molecular Properties
| Compound Name | hexafluoroarsenic(1-);tripropylazanium |
| PubChem CID | 45048798 |
| Molecular Formula | C9H22AsF6N |
| Molecular Weight | 333.19 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | hexafluoroarsenic(1-);tripropylazanium |
| SMILES | CCC[NH+](CCC)CCC.F[As-](F)(F)(F)(F)F |
| InChI | InChI=1S/C9H21N.AsF6/c1-4-7-10(8-5-2)9-6-3;2-1(3,4,5,6)7/h4-9H2,1-3H3;/q;-1/p+1 |
| InChIKey | FRABBUBGVLRYAV-UHFFFAOYSA-O |
| XLogP | 3.24 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.19 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze hexafluoroarsenic(1-);tripropylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexafluoroarsenic(1-);tripropylazanium?
The IUPAC name of hexafluoroarsenic(1-);tripropylazanium (CID 45048798) is hexafluoroarsenic(1-);tripropylazanium.
What is the SMILES notation for hexafluoroarsenic(1-);tripropylazanium?
The canonical SMILES for hexafluoroarsenic(1-);tripropylazanium is CCC[NH+](CCC)CCC.F[As-](F)(F)(F)(F)F.
What is the InChIKey of hexafluoroarsenic(1-);tripropylazanium?
The InChIKey is FRABBUBGVLRYAV-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H21N.AsF6/c1-4-7-10(8-5-2)9-6-3;2-1(3,4,5,6)7/h4-9H2,1-3H3;/q;-1/p+1.
What are the key properties of hexafluoroarsenic(1-);tripropylazanium?
hexafluoroarsenic(1-);tripropylazanium has a molecular weight of 333.19 g/mol, XLogP of 3.24, 6 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hexafluoroarsenic(1-);tripropylazanium is sourced from PubChem (CID 45048798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).