About hexafluoroarsenic(1-);propanenitrilium
hexafluoroarsenic(1-);propanenitrilium (PubChem CID 139168474) has the molecular formula C3H6AsF6N
and a molecular weight of 245.00 g/mol. Its IUPAC name is hexafluoroarsenic(1-);propanenitrilium.
Molecular Properties
| Compound Name | hexafluoroarsenic(1-);propanenitrilium |
| PubChem CID | 139168474 |
| Molecular Formula | C3H6AsF6N |
| Molecular Weight | 245.00 g/mol |
| Exact Mass | 244.96 |
| IUPAC Name | hexafluoroarsenic(1-);propanenitrilium |
| SMILES | CCC#[NH+].F[As-](F)(F)(F)(F)F |
| InChI | InChI=1S/C3H5N.AsF6/c1-2-3-4;2-1(3,4,5,6)7/h2H2,1H3;/q;-1/p+1 |
| InChIKey | BAQOGRLBXQYCDU-UHFFFAOYSA-O |
| XLogP | 1.31 |
| TPSA | 23.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.00 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze hexafluoroarsenic(1-);propanenitrilium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexafluoroarsenic(1-);propanenitrilium?
The IUPAC name of hexafluoroarsenic(1-);propanenitrilium (CID 139168474) is hexafluoroarsenic(1-);propanenitrilium.
What is the SMILES notation for hexafluoroarsenic(1-);propanenitrilium?
The canonical SMILES for hexafluoroarsenic(1-);propanenitrilium is CCC#[NH+].F[As-](F)(F)(F)(F)F.
What is the InChIKey of hexafluoroarsenic(1-);propanenitrilium?
The InChIKey is BAQOGRLBXQYCDU-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H5N.AsF6/c1-2-3-4;2-1(3,4,5,6)7/h2H2,1H3;/q;-1/p+1.
What are the key properties of hexafluoroarsenic(1-);propanenitrilium?
hexafluoroarsenic(1-);propanenitrilium has a molecular weight of 245.00 g/mol, XLogP of 1.31, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hexafluoroarsenic(1-);propanenitrilium is sourced from PubChem (CID 139168474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).