C18H30N4O6S2 — CID 18926785
5-amino-2-(4-amino-2-sulfonatophenyl)benzenesulfonate;bis(trimethylazanium) (PubChem CID 18926785) has the molecular formula C18H30N4O6S2 and a molecular weight of 462.59 g/mol. Its IUPAC name is 5-amino-2-(4-amino-2-sulfonatophenyl)benzenesulfonate;bis(trimethylazanium).
| Compound Name | 5-amino-2-(4-amino-2-sulfonatophenyl)benzenesulfonate;bis(trimethylazanium) |
|---|---|
| PubChem CID | 18926785 |
| Molecular Formula | C18H30N4O6S2 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 5-amino-2-(4-amino-2-sulfonatophenyl)benzenesulfonate;bis(trimethylazanium) |
| SMILES | C[NH+](C)C.C[NH+](C)C.Nc1ccc(-c2ccc(N)cc2S(=O)(=O)[O-])c(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C12H12N2O6S2.2C3H9N/c13-7-1-3-9(11(5-7)21(15,16)17)10-4-2-8(14)6-12(10)22(18,19)20;2*1-4(2)3/h1-6H,13-14H2,(H,15,16,17)(H,18,19,20);2*1-3H3 |
| InChIKey | LMJPRXCRSPQUQQ-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 175.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|