C10H22N2O5S — CID 11358019
N-(3-oxobutanoyl)sulfamate;triethylazanium (PubChem CID 11358019) has the molecular formula C10H22N2O5S and a molecular weight of 282.36 g/mol. Its IUPAC name is N-(3-oxobutanoyl)sulfamate;triethylazanium.
| Compound Name | N-(3-oxobutanoyl)sulfamate;triethylazanium |
|---|---|
| PubChem CID | 11358019 |
| Molecular Formula | C10H22N2O5S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | N-(3-oxobutanoyl)sulfamate;triethylazanium |
| SMILES | CC(=O)CC(=O)NS(=O)(=O)[O-].CC[NH+](CC)CC |
| InChI | InChI=1S/C6H15N.C4H7NO5S/c1-4-7(5-2)6-3;1-3(6)2-4(7)5-11(8,9)10/h4-6H2,1-3H3;2H2,1H3,(H,5,7)(H,8,9,10) |
| InChIKey | DMZUSFYWKZBCEV-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|