About sulfonato sulfate;bis(tetramethylphosphanium)
sulfonato sulfate;bis(tetramethylphosphanium) (PubChem CID 174869555) has the molecular formula C8H24O7P2S2
and a molecular weight of 358.36 g/mol. Its IUPAC name is sulfonato sulfate;bis(tetramethylphosphanium).
Molecular Properties
| Compound Name | sulfonato sulfate;bis(tetramethylphosphanium) |
| PubChem CID | 174869555 |
| Molecular Formula | C8H24O7P2S2 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | sulfonato sulfate;bis(tetramethylphosphanium) |
| SMILES | C[P+](C)(C)C.C[P+](C)(C)C.O=S(=O)([O-])OS(=O)(=O)[O-] |
| InChI | InChI=1S/2C4H12P.H2O7S2/c2*1-5(2,3)4;1-8(2,3)7-9(4,5)6/h2*1-4H3;(H,1,2,3)(H,4,5,6)/q2*+1;/p-2 |
| InChIKey | CAIPERJCADDXKE-UHFFFAOYSA-L |
| XLogP | 0.97 |
| TPSA | 123.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze sulfonato sulfate;bis(tetramethylphosphanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfonato sulfate;bis(tetramethylphosphanium)?
The IUPAC name of sulfonato sulfate;bis(tetramethylphosphanium) (CID 174869555) is sulfonato sulfate;bis(tetramethylphosphanium).
What is the SMILES notation for sulfonato sulfate;bis(tetramethylphosphanium)?
The canonical SMILES for sulfonato sulfate;bis(tetramethylphosphanium) is C[P+](C)(C)C.C[P+](C)(C)C.O=S(=O)([O-])OS(=O)(=O)[O-].
What is the InChIKey of sulfonato sulfate;bis(tetramethylphosphanium)?
The InChIKey is CAIPERJCADDXKE-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H12P.H2O7S2/c2*1-5(2,3)4;1-8(2,3)7-9(4,5)6/h2*1-4H3;(H,1,2,3)(H,4,5,6)/q2*+1;/p-2.
What are the key properties of sulfonato sulfate;bis(tetramethylphosphanium)?
sulfonato sulfate;bis(tetramethylphosphanium) has a molecular weight of 358.36 g/mol, XLogP of 0.97, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sulfonato sulfate;bis(tetramethylphosphanium) is sourced from PubChem (CID 174869555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).