About sodium sulfooxysulfonyl sulfate
sodium sulfooxysulfonyl sulfate (PubChem CID 175371917) has the molecular formula HNaO10S3
and a molecular weight of 280.19 g/mol. Its IUPAC name is sodium sulfooxysulfonyl sulfate.
Molecular Properties
| Compound Name | sodium sulfooxysulfonyl sulfate |
| PubChem CID | 175371917 |
| Molecular Formula | HNaO10S3 |
| Molecular Weight | 280.19 g/mol |
| Exact Mass | 279.86 |
| IUPAC Name | sodium sulfooxysulfonyl sulfate |
| SMILES | O=S(=O)([O-])OS(=O)(=O)OS(=O)(=O)O.[Na+] |
| InChI | InChI=1S/Na.H2O10S3/c;1-11(2,3)9-13(7,8)10-12(4,5)6/h;(H,1,2,3)(H,4,5,6)/q+1;/p-1 |
| InChIKey | OHHKTQPMDBNYKT-UHFFFAOYSA-M |
| XLogP | -5.47 |
| TPSA | 164.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.19 |
| LogP ≤ 5 | -5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze sodium sulfooxysulfonyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium sulfooxysulfonyl sulfate?
The IUPAC name of sodium sulfooxysulfonyl sulfate (CID 175371917) is sodium sulfooxysulfonyl sulfate.
What is the SMILES notation for sodium sulfooxysulfonyl sulfate?
The canonical SMILES for sodium sulfooxysulfonyl sulfate is O=S(=O)([O-])OS(=O)(=O)OS(=O)(=O)O.[Na+].
What is the InChIKey of sodium sulfooxysulfonyl sulfate?
The InChIKey is OHHKTQPMDBNYKT-UHFFFAOYSA-M. The full InChI is InChI=1S/Na.H2O10S3/c;1-11(2,3)9-13(7,8)10-12(4,5)6/h;(H,1,2,3)(H,4,5,6)/q+1;/p-1.
What are the key properties of sodium sulfooxysulfonyl sulfate?
sodium sulfooxysulfonyl sulfate has a molecular weight of 280.19 g/mol, XLogP of -5.47, 4 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for sodium sulfooxysulfonyl sulfate is sourced from PubChem (CID 175371917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).