silane;sulfo hydrogen sulfate

H8O14S4Si — CID 173332743

IUPACsilane;sulfo hydrogen sulfate
SMILESO=S(=O)(O)OS(=O)(=O)O.O=S(=O)(O)OS(=O)(=O)O.[SiH4]
InChIInChI=1S/2H2O7S2.H4Si/c2*1-8(2,3)7-9(4,5)6;/h2*(H,1,2,3)(H,4,5,6);1H4
InChIKeyGAIQTAJPJZTADX-UHFFFAOYSA-N
MW388.40 g/mol
LogP-4.23
Rot. Bonds4

About silane;sulfo hydrogen sulfate

silane;sulfo hydrogen sulfate (PubChem CID 173332743) has the molecular formula H8O14S4Si and a molecular weight of 388.40 g/mol. Its IUPAC name is silane;sulfo hydrogen sulfate.

Molecular Properties

Compound Namesilane;sulfo hydrogen sulfate
PubChem CID173332743
Molecular FormulaH8O14S4Si
Molecular Weight388.40 g/mol
Exact Mass387.86
IUPAC Namesilane;sulfo hydrogen sulfate
SMILESO=S(=O)(O)OS(=O)(=O)O.O=S(=O)(O)OS(=O)(=O)O.[SiH4]
InChIInChI=1S/2H2O7S2.H4Si/c2*1-8(2,3)7-9(4,5)6;/h2*(H,1,2,3)(H,4,5,6);1H4
InChIKeyGAIQTAJPJZTADX-UHFFFAOYSA-N
XLogP-4.23
TPSA235.94 Ų
H-Bond Donors4
H-Bond Acceptors10
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500388.40
LogP ≤ 5-4.23
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 1010

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze silane;sulfo hydrogen sulfate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

CID 173332753
CID 173332753
prop-1-ene;sulfo hydrogen sulfate
CID 158163736
CID 20507039
CID 20507039
potassium sulfo sulfate
CID 157130711
acetonitrile;bis(N,N-dimethylmethanamine);sulfo hydrogen sulfate
CID 174669975
hydrazine;(hydroxy-methylidene-oxo-λ6-sulfanyl) hydrogen sulfate
CID 175830323
CID 173431110
CID 173431110
potassium;sulfo sulfate;sulfuric acid
CID 158562224
sulfooxy hydrogen sulfate
CID 24413
benzoic acid;sulfo hydrogen sulfate
CID 174783789
sodium;hydride;hydrogen peroxide;hydroxy sulfo sulfate
CID 173090604
sodium sulfooxysulfonyl sulfate
CID 175371917

Frequently Asked Questions

What is the IUPAC name of silane;sulfo hydrogen sulfate?
The IUPAC name of silane;sulfo hydrogen sulfate (CID 173332743) is silane;sulfo hydrogen sulfate.
What is the SMILES notation for silane;sulfo hydrogen sulfate?
The canonical SMILES for silane;sulfo hydrogen sulfate is O=S(=O)(O)OS(=O)(=O)O.O=S(=O)(O)OS(=O)(=O)O.[SiH4].
What is the InChIKey of silane;sulfo hydrogen sulfate?
The InChIKey is GAIQTAJPJZTADX-UHFFFAOYSA-N. The full InChI is InChI=1S/2H2O7S2.H4Si/c2*1-8(2,3)7-9(4,5)6;/h2*(H,1,2,3)(H,4,5,6);1H4.
What are the key properties of silane;sulfo hydrogen sulfate?
silane;sulfo hydrogen sulfate has a molecular weight of 388.40 g/mol, XLogP of -4.23, 4 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for silane;sulfo hydrogen sulfate is sourced from PubChem (CID 173332743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).