H3KO11S3 — CID 158562224
potassium;sulfo sulfate;sulfuric acid (PubChem CID 158562224) has the molecular formula H3KO11S3 and a molecular weight of 314.31 g/mol. Its IUPAC name is potassium;sulfo sulfate;sulfuric acid.
| Compound Name | potassium;sulfo sulfate;sulfuric acid |
|---|---|
| PubChem CID | 158562224 |
| Molecular Formula | H3KO11S3 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 313.85 |
| IUPAC Name | potassium;sulfo sulfate;sulfuric acid |
| SMILES | O=S(=O)(O)O.O=S(=O)([O-])OS(=O)(=O)O.[K+] |
| InChI | InChI=1S/K.H2O7S2.H2O4S/c;1-8(2,3)7-9(4,5)6;1-5(2,3)4/h;(H,1,2,3)(H,4,5,6);(H2,1,2,3,4)/q+1;;/p-1 |
| InChIKey | HRAIBBFAAYBESA-UHFFFAOYSA-M |
| XLogP | -5.38 |
| TPSA | 195.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | -5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|