About potassium sulfo sulfate
potassium sulfo sulfate (PubChem CID 157130711) has the molecular formula HKO7S2
and a molecular weight of 216.23 g/mol. Its IUPAC name is potassium sulfo sulfate.
Molecular Properties
| Compound Name | potassium sulfo sulfate |
| PubChem CID | 157130711 |
| Molecular Formula | HKO7S2 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 215.88 |
| IUPAC Name | potassium sulfo sulfate |
| SMILES | O=S(=O)([O-])OS(=O)(=O)O.[K+] |
| InChI | InChI=1S/K.H2O7S2/c;1-8(2,3)7-9(4,5)6/h;(H,1,2,3)(H,4,5,6)/q+1;/p-1 |
| InChIKey | AJAOFQKSNNIVKB-UHFFFAOYSA-M |
| XLogP | -4.73 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | -4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze potassium sulfo sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium sulfo sulfate?
The IUPAC name of potassium sulfo sulfate (CID 157130711) is potassium sulfo sulfate.
What is the SMILES notation for potassium sulfo sulfate?
The canonical SMILES for potassium sulfo sulfate is O=S(=O)([O-])OS(=O)(=O)O.[K+].
What is the InChIKey of potassium sulfo sulfate?
The InChIKey is AJAOFQKSNNIVKB-UHFFFAOYSA-M. The full InChI is InChI=1S/K.H2O7S2/c;1-8(2,3)7-9(4,5)6/h;(H,1,2,3)(H,4,5,6)/q+1;/p-1.
What are the key properties of potassium sulfo sulfate?
potassium sulfo sulfate has a molecular weight of 216.23 g/mol, XLogP of -4.73, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for potassium sulfo sulfate is sourced from PubChem (CID 157130711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).