K2O9S4 — CID 174554201
dipotassium;sulfonatooxysulfonothioyl sulfate (PubChem CID 174554201) has the molecular formula K2O9S4 and a molecular weight of 350.46 g/mol. Its IUPAC name is dipotassium;sulfonatooxysulfonothioyl sulfate.
| Compound Name | dipotassium;sulfonatooxysulfonothioyl sulfate |
|---|---|
| PubChem CID | 174554201 |
| Molecular Formula | K2O9S4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 349.77 |
| IUPAC Name | dipotassium;sulfonatooxysulfonothioyl sulfate |
| SMILES | O=S(=O)([O-])OS(=O)(=S)OS(=O)(=O)[O-].[K+].[K+] |
| InChI | InChI=1S/2K.H2O9S4/c;;1-11(2,3)8-13(7,10)9-12(4,5)6/h;;(H,1,2,3)(H,4,5,6)/q2*+1;/p-2 |
| InChIKey | KZNGISIJBIMIHU-UHFFFAOYSA-L |
| XLogP | -8.48 |
| TPSA | 149.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | -8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|