About platinum(4+);sulfonato sulfate
platinum(4+);sulfonato sulfate (PubChem CID 57353350) has the molecular formula O14PtS4
and a molecular weight of 547.33 g/mol. Its IUPAC name is platinum(4+);sulfonato sulfate.
Molecular Properties
| Compound Name | platinum(4+);sulfonato sulfate |
| PubChem CID | 57353350 |
| Molecular Formula | O14PtS4 |
| Molecular Weight | 547.33 g/mol |
| Exact Mass | 546.78 |
| IUPAC Name | platinum(4+);sulfonato sulfate |
| SMILES | O=S(=O)([O-])OS(=O)(=O)[O-].O=S(=O)([O-])OS(=O)(=O)[O-].[Pt+4] |
| InChI | InChI=1S/2H2O7S2.Pt/c2*1-8(2,3)7-9(4,5)6;/h2*(H,1,2,3)(H,4,5,6);/q;;+4/p-4 |
| InChIKey | SRBAUCXPNREGLR-UHFFFAOYSA-J |
| XLogP | -4.16 |
| TPSA | 247.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 547.33 |
| LogP ≤ 5 | -4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze platinum(4+);sulfonato sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of platinum(4+);sulfonato sulfate?
The IUPAC name of platinum(4+);sulfonato sulfate (CID 57353350) is platinum(4+);sulfonato sulfate.
What is the SMILES notation for platinum(4+);sulfonato sulfate?
The canonical SMILES for platinum(4+);sulfonato sulfate is O=S(=O)([O-])OS(=O)(=O)[O-].O=S(=O)([O-])OS(=O)(=O)[O-].[Pt+4].
What is the InChIKey of platinum(4+);sulfonato sulfate?
The InChIKey is SRBAUCXPNREGLR-UHFFFAOYSA-J. The full InChI is InChI=1S/2H2O7S2.Pt/c2*1-8(2,3)7-9(4,5)6;/h2*(H,1,2,3)(H,4,5,6);/q;;+4/p-4.
What are the key properties of platinum(4+);sulfonato sulfate?
platinum(4+);sulfonato sulfate has a molecular weight of 547.33 g/mol, XLogP of -4.16, 4 rotatable bonds, 0 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for platinum(4+);sulfonato sulfate is sourced from PubChem (CID 57353350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).