hydrazine;(hydroxy-methylidene-oxo-λ6-sulfanyl) hydrogen sulfate

CH8N2O6S2 — CID 175830323

IUPAChydrazine;(hydroxy-methylidene-oxo-λ6-sulfanyl) hydrogen sulfate
SMILESC=S(=O)(O)OS(=O)(=O)O.NN
InChIInChI=1S/CH4O6S2.H4N2/c1-8(2,3)7-9(4,5)6;1-2/h1H2,(H,2,3)(H,4,5,6);1-2H2
InChIKeyLWIRCGKLLSTYMO-UHFFFAOYSA-N
MW208.22 g/mol
LogP-2.27
Rot. Bonds2

About hydrazine;(hydroxy-methylidene-oxo-λ6-sulfanyl) hydrogen sulfate

hydrazine;(hydroxy-methylidene-oxo-λ6-sulfanyl) hydrogen sulfate (PubChem CID 175830323) has the molecular formula CH8N2O6S2 and a molecular weight of 208.22 g/mol. Its IUPAC name is hydrazine;(hydroxy-methylidene-oxo-λ6-sulfanyl) hydrogen sulfate.

Molecular Properties

Compound Namehydrazine;(hydroxy-methylidene-oxo-λ6-sulfanyl) hydrogen sulfate
PubChem CID175830323
Molecular FormulaCH8N2O6S2
Molecular Weight208.22 g/mol
Exact Mass207.98
IUPAC Namehydrazine;(hydroxy-methylidene-oxo-λ6-sulfanyl) hydrogen sulfate
SMILESC=S(=O)(O)OS(=O)(=O)O.NN
InChIInChI=1S/CH4O6S2.H4N2/c1-8(2,3)7-9(4,5)6;1-2/h1H2,(H,2,3)(H,4,5,6);1-2H2
InChIKeyLWIRCGKLLSTYMO-UHFFFAOYSA-N
XLogP-2.27
TPSA152.94 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.22
LogP ≤ 5-2.27
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}

Analyze hydrazine;(hydroxy-methylidene-oxo-λ6-sulfanyl) hydrogen sulfate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

CID 173332753
CID 173332753
silane;sulfo hydrogen sulfate
CID 173332743
prop-1-ene;sulfo hydrogen sulfate
CID 158163736
CID 20507039
CID 20507039
potassium sulfo sulfate
CID 157130711
CID 131879747
CID 131879747
potassium;sulfo sulfate;sulfuric acid
CID 158562224
CID 173431110
CID 173431110
azane;hydrazine;sulfuric acid;hydrate
CID 174464189
sulfooxy hydrogen sulfate
CID 24413
sulfamoyl sulfamate
CID 22496615
sodium;formaldehyde;hydride;sulfooxy hydrogen sulfate
CID 173280994

Frequently Asked Questions

What is the IUPAC name of hydrazine;(hydroxy-methylidene-oxo-λ6-sulfanyl) hydrogen sulfate?
The IUPAC name of hydrazine;(hydroxy-methylidene-oxo-λ6-sulfanyl) hydrogen sulfate (CID 175830323) is hydrazine;(hydroxy-methylidene-oxo-λ6-sulfanyl) hydrogen sulfate.
What is the SMILES notation for hydrazine;(hydroxy-methylidene-oxo-λ6-sulfanyl) hydrogen sulfate?
The canonical SMILES for hydrazine;(hydroxy-methylidene-oxo-λ6-sulfanyl) hydrogen sulfate is C=S(=O)(O)OS(=O)(=O)O.NN.
What is the InChIKey of hydrazine;(hydroxy-methylidene-oxo-λ6-sulfanyl) hydrogen sulfate?
The InChIKey is LWIRCGKLLSTYMO-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4O6S2.H4N2/c1-8(2,3)7-9(4,5)6;1-2/h1H2,(H,2,3)(H,4,5,6);1-2H2.
What are the key properties of hydrazine;(hydroxy-methylidene-oxo-λ6-sulfanyl) hydrogen sulfate?
hydrazine;(hydroxy-methylidene-oxo-λ6-sulfanyl) hydrogen sulfate has a molecular weight of 208.22 g/mol, XLogP of -2.27, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;(hydroxy-methylidene-oxo-λ6-sulfanyl) hydrogen sulfate is sourced from PubChem (CID 175830323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).