About azane;hydron;1-sulfoethanesulfonate
azane;hydron;1-sulfoethanesulfonate (PubChem CID 173184387) has the molecular formula C2H9NO6S2
and a molecular weight of 207.23 g/mol. Its IUPAC name is azane;hydron;1-sulfoethanesulfonate.
Molecular Properties
| Compound Name | azane;hydron;1-sulfoethanesulfonate |
| PubChem CID | 173184387 |
| Molecular Formula | C2H9NO6S2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 206.99 |
| IUPAC Name | azane;hydron;1-sulfoethanesulfonate |
| SMILES | CC(S(=O)(=O)[O-])S(=O)(=O)O.N.[H+] |
| InChI | InChI=1S/C2H6O6S2.H3N/c1-2(9(3,4)5)10(6,7)8;/h2H,1H3,(H,3,4,5)(H,6,7,8);1H3 |
| InChIKey | ZYTPVYLRLQAQEZ-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 146.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze azane;hydron;1-sulfoethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;hydron;1-sulfoethanesulfonate?
The IUPAC name of azane;hydron;1-sulfoethanesulfonate (CID 173184387) is azane;hydron;1-sulfoethanesulfonate.
What is the SMILES notation for azane;hydron;1-sulfoethanesulfonate?
The canonical SMILES for azane;hydron;1-sulfoethanesulfonate is CC(S(=O)(=O)[O-])S(=O)(=O)O.N.[H+].
What is the InChIKey of azane;hydron;1-sulfoethanesulfonate?
The InChIKey is ZYTPVYLRLQAQEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6O6S2.H3N/c1-2(9(3,4)5)10(6,7)8;/h2H,1H3,(H,3,4,5)(H,6,7,8);1H3.
What are the key properties of azane;hydron;1-sulfoethanesulfonate?
azane;hydron;1-sulfoethanesulfonate has a molecular weight of 207.23 g/mol, XLogP of -0.96, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;hydron;1-sulfoethanesulfonate is sourced from PubChem (CID 173184387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).