About iron(2+);bis(N-methylsulfamate)
iron(2+);bis(N-methylsulfamate) (PubChem CID 175322487) has the molecular formula C2H8FeN2O6S2
and a molecular weight of 276.07 g/mol. Its IUPAC name is iron(2+);bis(N-methylsulfamate).
Molecular Properties
| Compound Name | iron(2+);bis(N-methylsulfamate) |
| PubChem CID | 175322487 |
| Molecular Formula | C2H8FeN2O6S2 |
| Molecular Weight | 276.07 g/mol |
| Exact Mass | 275.92 |
| IUPAC Name | iron(2+);bis(N-methylsulfamate) |
| SMILES | CNS(=O)(=O)[O-].CNS(=O)(=O)[O-].[Fe+2] |
| InChI | InChI=1S/2CH5NO3S.Fe/c2*1-2-6(3,4)5;/h2*2H,1H3,(H,3,4,5);/q;;+2/p-2 |
| InChIKey | VVTAPQDWWGVUHS-UHFFFAOYSA-L |
| XLogP | -2.67 |
| TPSA | 138.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.07 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze iron(2+);bis(N-methylsulfamate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron(2+);bis(N-methylsulfamate)?
The IUPAC name of iron(2+);bis(N-methylsulfamate) (CID 175322487) is iron(2+);bis(N-methylsulfamate).
What is the SMILES notation for iron(2+);bis(N-methylsulfamate)?
The canonical SMILES for iron(2+);bis(N-methylsulfamate) is CNS(=O)(=O)[O-].CNS(=O)(=O)[O-].[Fe+2].
What is the InChIKey of iron(2+);bis(N-methylsulfamate)?
The InChIKey is VVTAPQDWWGVUHS-UHFFFAOYSA-L. The full InChI is InChI=1S/2CH5NO3S.Fe/c2*1-2-6(3,4)5;/h2*2H,1H3,(H,3,4,5);/q;;+2/p-2.
What are the key properties of iron(2+);bis(N-methylsulfamate)?
iron(2+);bis(N-methylsulfamate) has a molecular weight of 276.07 g/mol, XLogP of -2.67, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for iron(2+);bis(N-methylsulfamate) is sourced from PubChem (CID 175322487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).