About azanium N-tert-butylsulfamate
azanium N-tert-butylsulfamate (PubChem CID 87696521) has the molecular formula C4H14N2O3S
and a molecular weight of 170.23 g/mol. Its IUPAC name is azanium N-tert-butylsulfamate.
Molecular Properties
| Compound Name | azanium N-tert-butylsulfamate |
| PubChem CID | 87696521 |
| Molecular Formula | C4H14N2O3S |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | azanium N-tert-butylsulfamate |
| SMILES | CC(C)(C)NS(=O)(=O)[O-].[NH4+] |
| InChI | InChI=1S/C4H11NO3S.H3N/c1-4(2,3)5-9(6,7)8;/h5H,1-3H3,(H,6,7,8);1H3 |
| InChIKey | MWCIBOWINYOLNS-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 105.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze azanium N-tert-butylsulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium N-tert-butylsulfamate?
The IUPAC name of azanium N-tert-butylsulfamate (CID 87696521) is azanium N-tert-butylsulfamate.
What is the SMILES notation for azanium N-tert-butylsulfamate?
The canonical SMILES for azanium N-tert-butylsulfamate is CC(C)(C)NS(=O)(=O)[O-].[NH4+].
What is the InChIKey of azanium N-tert-butylsulfamate?
The InChIKey is MWCIBOWINYOLNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO3S.H3N/c1-4(2,3)5-9(6,7)8;/h5H,1-3H3,(H,6,7,8);1H3.
What are the key properties of azanium N-tert-butylsulfamate?
azanium N-tert-butylsulfamate has a molecular weight of 170.23 g/mol, XLogP of 0.21, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azanium N-tert-butylsulfamate is sourced from PubChem (CID 87696521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).